C15H18FN2O2+ — CID 8918803
[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]-[(1S)-1-(furan-2-yl)ethyl]azanium (PubChem CID 8918803) has the molecular formula C15H18FN2O2+ and a molecular weight of 277.32 g/mol. Its IUPAC name is [2-[(4-fluorophenyl)methylamino]-2-oxoethyl]-[(1S)-1-(furan-2-yl)ethyl]azanium.
| Compound Name | [2-[(4-fluorophenyl)methylamino]-2-oxoethyl]-[(1S)-1-(furan-2-yl)ethyl]azanium |
|---|---|
| PubChem CID | 8918803 |
| Molecular Formula | C15H18FN2O2+ |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | [2-[(4-fluorophenyl)methylamino]-2-oxoethyl]-[(1S)-1-(furan-2-yl)ethyl]azanium |
| SMILES | C[C@H]([NH2+]CC(=O)NCc1ccc(F)cc1)c1ccco1 |
| InChI | InChI=1S/C15H17FN2O2/c1-11(14-3-2-8-20-14)17-10-15(19)18-9-12-4-6-13(16)7-5-12/h2-8,11,17H,9-10H2,1H3,(H,18,19)/p+1/t11-/m0/s1 |
| InChIKey | RDIMIJIZRUMKTA-NSHDSACASA-O |
| XLogP | 1.36 |
| TPSA | 58.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |