C23H26N3O3+ — CID 8922795
[(1R)-1-(furan-2-yl)ethyl]-[2-oxo-2-[2-(2-phenylethylcarbamoyl)anilino]ethyl]azanium (PubChem CID 8922795) has the molecular formula C23H26N3O3+ and a molecular weight of 392.48 g/mol. Its IUPAC name is [(1R)-1-(furan-2-yl)ethyl]-[2-oxo-2-[2-(2-phenylethylcarbamoyl)anilino]ethyl]azanium.
| Compound Name | [(1R)-1-(furan-2-yl)ethyl]-[2-oxo-2-[2-(2-phenylethylcarbamoyl)anilino]ethyl]azanium |
|---|---|
| PubChem CID | 8922795 |
| Molecular Formula | C23H26N3O3+ |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | [(1R)-1-(furan-2-yl)ethyl]-[2-oxo-2-[2-(2-phenylethylcarbamoyl)anilino]ethyl]azanium |
| SMILES | C[C@@H]([NH2+]CC(=O)Nc1ccccc1C(=O)NCCc1ccccc1)c1ccco1 |
| InChI | InChI=1S/C23H25N3O3/c1-17(21-12-7-15-29-21)25-16-22(27)26-20-11-6-5-10-19(20)23(28)24-14-13-18-8-3-2-4-9-18/h2-12,15,17,25H,13-14,16H2,1H3,(H,24,28)(H,26,27)/p+1/t17-/m1/s1 |
| InChIKey | QDDDTXTUBADNMD-QGZVFWFLSA-O |
| XLogP | 2.52 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |