C23H23N3O4 — CID 35743644
N-methyl-N-[2-oxo-2-[2-(2-phenylethylcarbamoyl)anilino]ethyl]furan-2-carboxamide (PubChem CID 35743644) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is N-methyl-N-[2-oxo-2-[2-(2-phenylethylcarbamoyl)anilino]ethyl]furan-2-carboxamide.
| Compound Name | N-methyl-N-[2-oxo-2-[2-(2-phenylethylcarbamoyl)anilino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 35743644 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | N-methyl-N-[2-oxo-2-[2-(2-phenylethylcarbamoyl)anilino]ethyl]furan-2-carboxamide |
| SMILES | CN(CC(=O)Nc1ccccc1C(=O)NCCc1ccccc1)C(=O)c1ccco1 |
| InChI | InChI=1S/C23H23N3O4/c1-26(23(29)20-12-7-15-30-20)16-21(27)25-19-11-6-5-10-18(19)22(28)24-14-13-17-8-3-2-4-9-17/h2-12,15H,13-14,16H2,1H3,(H,24,28)(H,25,27) |
| InChIKey | MAUDXSPEOZQPKN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |