C16H19N3O5S — CID 55984585
N-[2-[2-(dimethylsulfamoyl)anilino]-2-oxoethyl]-N-methylfuran-2-carboxamide (PubChem CID 55984585) has the molecular formula C16H19N3O5S and a molecular weight of 365.41 g/mol. Its IUPAC name is N-[2-[2-(dimethylsulfamoyl)anilino]-2-oxoethyl]-N-methylfuran-2-carboxamide.
| Compound Name | N-[2-[2-(dimethylsulfamoyl)anilino]-2-oxoethyl]-N-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 55984585 |
| Molecular Formula | C16H19N3O5S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | N-[2-[2-(dimethylsulfamoyl)anilino]-2-oxoethyl]-N-methylfuran-2-carboxamide |
| SMILES | CN(CC(=O)Nc1ccccc1S(=O)(=O)N(C)C)C(=O)c1ccco1 |
| InChI | InChI=1S/C16H19N3O5S/c1-18(2)25(22,23)14-9-5-4-7-12(14)17-15(20)11-19(3)16(21)13-8-6-10-24-13/h4-10H,11H2,1-3H3,(H,17,20) |
| InChIKey | GZUAFFKJZNONQR-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |