C17H21N3O3S — CID 47070902
N-[2-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-ylamino)-2-oxoethyl]-N-methylfuran-2-carboxamide (PubChem CID 47070902) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is N-[2-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-ylamino)-2-oxoethyl]-N-methylfuran-2-carboxamide.
| Compound Name | N-[2-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-ylamino)-2-oxoethyl]-N-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 47070902 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N-[2-(4,5,6,7,8,9-hexahydrocycloocta[d][1,3]thiazol-2-ylamino)-2-oxoethyl]-N-methylfuran-2-carboxamide |
| SMILES | CN(CC(=O)Nc1nc2c(s1)CCCCCC2)C(=O)c1ccco1 |
| InChI | InChI=1S/C17H21N3O3S/c1-20(16(22)13-8-6-10-23-13)11-15(21)19-17-18-12-7-4-2-3-5-9-14(12)24-17/h6,8,10H,2-5,7,9,11H2,1H3,(H,18,19,21) |
| InChIKey | SMJRIUDRLXJIQJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |