C13H15N3OS2 — CID 19676492
1-(furan-2-ylmethyl)-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)thiourea (PubChem CID 19676492) has the molecular formula C13H15N3OS2 and a molecular weight of 293.42 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)thiourea.
| Compound Name | 1-(furan-2-ylmethyl)-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)thiourea |
|---|---|
| PubChem CID | 19676492 |
| Molecular Formula | C13H15N3OS2 |
| Molecular Weight | 293.42 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)thiourea |
| SMILES | S=C(NCc1ccco1)Nc1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C13H15N3OS2/c18-12(14-8-9-4-3-7-17-9)16-13-15-10-5-1-2-6-11(10)19-13/h3-4,7H,1-2,5-6,8H2,(H2,14,15,16,18) |
| InChIKey | XCMHXHNZTRAIPK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|