C20H20ClN2O2S+ — CID 8918823
[2-[2-(4-chlorophenyl)sulfanylanilino]-2-oxoethyl]-[(1R)-1-(furan-2-yl)ethyl]azanium (PubChem CID 8918823) has the molecular formula C20H20ClN2O2S+ and a molecular weight of 387.91 g/mol. Its IUPAC name is [2-[2-(4-chlorophenyl)sulfanylanilino]-2-oxoethyl]-[(1R)-1-(furan-2-yl)ethyl]azanium.
| Compound Name | [2-[2-(4-chlorophenyl)sulfanylanilino]-2-oxoethyl]-[(1R)-1-(furan-2-yl)ethyl]azanium |
|---|---|
| PubChem CID | 8918823 |
| Molecular Formula | C20H20ClN2O2S+ |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | [2-[2-(4-chlorophenyl)sulfanylanilino]-2-oxoethyl]-[(1R)-1-(furan-2-yl)ethyl]azanium |
| SMILES | C[C@@H]([NH2+]CC(=O)Nc1ccccc1Sc1ccc(Cl)cc1)c1ccco1 |
| InChI | InChI=1S/C20H19ClN2O2S/c1-14(18-6-4-12-25-18)22-13-20(24)23-17-5-2-3-7-19(17)26-16-10-8-15(21)9-11-16/h2-12,14,22H,13H2,1H3,(H,23,24)/p+1/t14-/m1/s1 |
| InChIKey | WVLVNTCCPUHLBU-CQSZACIVSA-O |
| XLogP | 4.35 |
| TPSA | 58.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |