C12H18N3O3+ — CID 8920889
[2-(cyclopropylcarbamoylamino)-2-oxoethyl]-[(1R)-1-(furan-2-yl)ethyl]azanium (PubChem CID 8920889) has the molecular formula C12H18N3O3+ and a molecular weight of 252.29 g/mol. Its IUPAC name is [2-(cyclopropylcarbamoylamino)-2-oxoethyl]-[(1R)-1-(furan-2-yl)ethyl]azanium.
| Compound Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl]-[(1R)-1-(furan-2-yl)ethyl]azanium |
|---|---|
| PubChem CID | 8920889 |
| Molecular Formula | C12H18N3O3+ |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl]-[(1R)-1-(furan-2-yl)ethyl]azanium |
| SMILES | C[C@@H]([NH2+]CC(=O)NC(=O)NC1CC1)c1ccco1 |
| InChI | InChI=1S/C12H17N3O3/c1-8(10-3-2-6-18-10)13-7-11(16)15-12(17)14-9-4-5-9/h2-3,6,8-9,13H,4-5,7H2,1H3,(H2,14,15,16,17)/p+1/t8-/m1/s1 |
| InChIKey | VLMBJQMIDZRWOJ-MRVPVSSYSA-O |
| XLogP | -0.11 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |