C15H16N2O4 — CID 25219998
2-(N-[2-(furan-2-ylmethylamino)-2-oxoethyl]anilino)acetic acid (PubChem CID 25219998) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is 2-(N-[2-(furan-2-ylmethylamino)-2-oxoethyl]anilino)acetic acid.
| Compound Name | 2-(N-[2-(furan-2-ylmethylamino)-2-oxoethyl]anilino)acetic acid |
|---|---|
| PubChem CID | 25219998 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 2-(N-[2-(furan-2-ylmethylamino)-2-oxoethyl]anilino)acetic acid |
| SMILES | O=C(O)CN(CC(=O)NCc1ccco1)c1ccccc1 |
| InChI | InChI=1S/C15H16N2O4/c18-14(16-9-13-7-4-8-21-13)10-17(11-15(19)20)12-5-2-1-3-6-12/h1-8H,9-11H2,(H,16,18)(H,19,20) |
| InChIKey | DUVAZEKEUADJEQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |