C10H21N3O5 — CID 60686668
2-[bis(2-hydroxyethyl)amino]-N-(2-methoxyethylcarbamoyl)acetamide (PubChem CID 60686668) has the molecular formula C10H21N3O5 and a molecular weight of 263.29 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]-N-(2-methoxyethylcarbamoyl)acetamide.
| Compound Name | 2-[bis(2-hydroxyethyl)amino]-N-(2-methoxyethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 60686668 |
| Molecular Formula | C10H21N3O5 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]-N-(2-methoxyethylcarbamoyl)acetamide |
| SMILES | COCCNC(=O)NC(=O)CN(CCO)CCO |
| InChI | InChI=1S/C10H21N3O5/c1-18-7-2-11-10(17)12-9(16)8-13(3-5-14)4-6-15/h14-15H,2-8H2,1H3,(H2,11,12,16,17) |
| InChIKey | ONYQKUPQKGEVQI-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|