C12H24N4O5 — CID 107425846
2-[2-(dimethylamino)ethyl-[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl]amino]acetic acid (PubChem CID 107425846) has the molecular formula C12H24N4O5 and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethyl-[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl]amino]acetic acid.
| Compound Name | 2-[2-(dimethylamino)ethyl-[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl]amino]acetic acid |
|---|---|
| PubChem CID | 107425846 |
| Molecular Formula | C12H24N4O5 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 2-[2-(dimethylamino)ethyl-[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl]amino]acetic acid |
| SMILES | COCCNC(=O)NC(=O)CN(CCN(C)C)CC(=O)O |
| InChI | InChI=1S/C12H24N4O5/c1-15(2)5-6-16(9-11(18)19)8-10(17)14-12(20)13-4-7-21-3/h4-9H2,1-3H3,(H,18,19)(H2,13,14,17,20) |
| InChIKey | CDXIJLAVVXYAIH-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|