About 2-[2,2-dimethoxyethyl(methyl)amino]-N-propylacetamide
2-[2,2-dimethoxyethyl(methyl)amino]-N-propylacetamide (PubChem CID 66221480) has the molecular formula C10H22N2O3
and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-[2,2-dimethoxyethyl(methyl)amino]-N-propylacetamide.
Molecular Properties
| Compound Name | 2-[2,2-dimethoxyethyl(methyl)amino]-N-propylacetamide |
| PubChem CID | 66221480 |
| Molecular Formula | C10H22N2O3 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | 2-[2,2-dimethoxyethyl(methyl)amino]-N-propylacetamide |
| SMILES | CCCNC(=O)CN(C)CC(OC)OC |
| InChI | InChI=1S/C10H22N2O3/c1-5-6-11-9(13)7-12(2)8-10(14-3)15-4/h10H,5-8H2,1-4H3,(H,11,13) |
| InChIKey | RSMDUJSTHSRITB-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,2-dimethoxyethyl(methyl)amino]-N-propylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-dimethoxyethyl(methyl)amino]-N-propylacetamide?
The IUPAC name of 2-[2,2-dimethoxyethyl(methyl)amino]-N-propylacetamide (CID 66221480) is 2-[2,2-dimethoxyethyl(methyl)amino]-N-propylacetamide.
What is the SMILES notation for 2-[2,2-dimethoxyethyl(methyl)amino]-N-propylacetamide?
The canonical SMILES for 2-[2,2-dimethoxyethyl(methyl)amino]-N-propylacetamide is CCCNC(=O)CN(C)CC(OC)OC.
What is the InChIKey of 2-[2,2-dimethoxyethyl(methyl)amino]-N-propylacetamide?
The InChIKey is RSMDUJSTHSRITB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O3/c1-5-6-11-9(13)7-12(2)8-10(14-3)15-4/h10H,5-8H2,1-4H3,(H,11,13).
What are the key properties of 2-[2,2-dimethoxyethyl(methyl)amino]-N-propylacetamide?
2-[2,2-dimethoxyethyl(methyl)amino]-N-propylacetamide has a molecular weight of 218.30 g/mol, XLogP of 0.06, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-dimethoxyethyl(methyl)amino]-N-propylacetamide is sourced from PubChem (CID 66221480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).