About N-butyl-N'-(2-methoxyethyl)oxamide
N-butyl-N'-(2-methoxyethyl)oxamide (PubChem CID 2291239) has the molecular formula C9H18N2O3
and a molecular weight of 202.25 g/mol. Its IUPAC name is N-butyl-N'-(2-methoxyethyl)oxamide.
Molecular Properties
| Compound Name | N-butyl-N'-(2-methoxyethyl)oxamide |
| PubChem CID | 2291239 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | N-butyl-N'-(2-methoxyethyl)oxamide |
| SMILES | CCCCNC(=O)C(=O)NCCOC |
| InChI | InChI=1S/C9H18N2O3/c1-3-4-5-10-8(12)9(13)11-6-7-14-2/h3-7H2,1-2H3,(H,10,12)(H,11,13) |
| InChIKey | YYGKMRIIXJKIMP-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-N'-(2-methoxyethyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N'-(2-methoxyethyl)oxamide?
The IUPAC name of N-butyl-N'-(2-methoxyethyl)oxamide (CID 2291239) is N-butyl-N'-(2-methoxyethyl)oxamide.
What is the SMILES notation for N-butyl-N'-(2-methoxyethyl)oxamide?
The canonical SMILES for N-butyl-N'-(2-methoxyethyl)oxamide is CCCCNC(=O)C(=O)NCCOC.
What is the InChIKey of N-butyl-N'-(2-methoxyethyl)oxamide?
The InChIKey is YYGKMRIIXJKIMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O3/c1-3-4-5-10-8(12)9(13)11-6-7-14-2/h3-7H2,1-2H3,(H,10,12)(H,11,13).
What are the key properties of N-butyl-N'-(2-methoxyethyl)oxamide?
N-butyl-N'-(2-methoxyethyl)oxamide has a molecular weight of 202.25 g/mol, XLogP of -0.33, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N'-(2-methoxyethyl)oxamide is sourced from PubChem (CID 2291239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).