C6H12N2O4 — CID 2774688
N'-(2,2-dimethoxyethyl)oxamide (PubChem CID 2774688) has the molecular formula C6H12N2O4 and a molecular weight of 176.17 g/mol. Its IUPAC name is N'-(2,2-dimethoxyethyl)oxamide.
| Compound Name | N'-(2,2-dimethoxyethyl)oxamide |
|---|---|
| PubChem CID | 2774688 |
| Molecular Formula | C6H12N2O4 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | N'-(2,2-dimethoxyethyl)oxamide |
| SMILES | COC(CNC(=O)C(N)=O)OC |
| InChI | InChI=1S/C6H12N2O4/c1-11-4(12-2)3-8-6(10)5(7)9/h4H,3H2,1-2H3,(H2,7,9)(H,8,10) |
| InChIKey | SEDMUCLYVKEAGO-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|