C9H16N2O5 — CID 18741303
N-(2,2-dimethoxyethyl)-N'-(2-oxopropyl)oxamide (PubChem CID 18741303) has the molecular formula C9H16N2O5 and a molecular weight of 232.24 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-N'-(2-oxopropyl)oxamide.
| Compound Name | N-(2,2-dimethoxyethyl)-N'-(2-oxopropyl)oxamide |
|---|---|
| PubChem CID | 18741303 |
| Molecular Formula | C9H16N2O5 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-N'-(2-oxopropyl)oxamide |
| SMILES | COC(CNC(=O)C(=O)NCC(C)=O)OC |
| InChI | InChI=1S/C9H16N2O5/c1-6(12)4-10-8(13)9(14)11-5-7(15-2)16-3/h7H,4-5H2,1-3H3,(H,10,13)(H,11,14) |
| InChIKey | JPDWMTCOLARJOL-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|