C13H26N2O4 — CID 58123036
N-(2-acetamidoethyl)-N-(2,2-diethoxyethyl)propanamide (PubChem CID 58123036) has the molecular formula C13H26N2O4 and a molecular weight of 274.36 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-N-(2,2-diethoxyethyl)propanamide.
| Compound Name | N-(2-acetamidoethyl)-N-(2,2-diethoxyethyl)propanamide |
|---|---|
| PubChem CID | 58123036 |
| Molecular Formula | C13H26N2O4 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | N-(2-acetamidoethyl)-N-(2,2-diethoxyethyl)propanamide |
| SMILES | CCOC(CN(CCNC(C)=O)C(=O)CC)OCC |
| InChI | InChI=1S/C13H26N2O4/c1-5-12(17)15(9-8-14-11(4)16)10-13(18-6-2)19-7-3/h13H,5-10H2,1-4H3,(H,14,16) |
| InChIKey | FYCOERLIFBZTQP-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|