C9H17NO4 — CID 58111384
N-(2,2-dimethoxyethyl)-2-oxopentanamide (PubChem CID 58111384) has the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-2-oxopentanamide.
| Compound Name | N-(2,2-dimethoxyethyl)-2-oxopentanamide |
|---|---|
| PubChem CID | 58111384 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-2-oxopentanamide |
| SMILES | CCCC(=O)C(=O)NCC(OC)OC |
| InChI | InChI=1S/C9H17NO4/c1-4-5-7(11)9(12)10-6-8(13-2)14-3/h8H,4-6H2,1-3H3,(H,10,12) |
| InChIKey | IQOAKCUDJGNMCQ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|