C7H14N2O4 — CID 44997786
N'-(2,2-dimethoxyethyl)-N-methyloxamide (PubChem CID 44997786) has the molecular formula C7H14N2O4 and a molecular weight of 190.20 g/mol. Its IUPAC name is N'-(2,2-dimethoxyethyl)-N-methyloxamide.
| Compound Name | N'-(2,2-dimethoxyethyl)-N-methyloxamide |
|---|---|
| PubChem CID | 44997786 |
| Molecular Formula | C7H14N2O4 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | N'-(2,2-dimethoxyethyl)-N-methyloxamide |
| SMILES | CNC(=O)C(=O)NCC(OC)OC |
| InChI | InChI=1S/C7H14N2O4/c1-8-6(10)7(11)9-4-5(12-2)13-3/h5H,4H2,1-3H3,(H,8,10)(H,9,11) |
| InChIKey | LTXZVDTTYLWCBS-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|