C13H20BrN3O2S — CID 26650831
2-[(5-bromothiophen-2-yl)methyl-methylamino]-N-(butylcarbamoyl)acetamide (PubChem CID 26650831) has the molecular formula C13H20BrN3O2S and a molecular weight of 362.29 g/mol. Its IUPAC name is 2-[(5-bromothiophen-2-yl)methyl-methylamino]-N-(butylcarbamoyl)acetamide.
| Compound Name | 2-[(5-bromothiophen-2-yl)methyl-methylamino]-N-(butylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 26650831 |
| Molecular Formula | C13H20BrN3O2S |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 2-[(5-bromothiophen-2-yl)methyl-methylamino]-N-(butylcarbamoyl)acetamide |
| SMILES | CCCCNC(=O)NC(=O)CN(C)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C13H20BrN3O2S/c1-3-4-7-15-13(19)16-12(18)9-17(2)8-10-5-6-11(14)20-10/h5-6H,3-4,7-9H2,1-2H3,(H2,15,16,18,19) |
| InChIKey | DHQGQCZNZXPIBN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|