C11H21N3 — CID 139338168
(2E)-N,N-dimethyl-4-piperazin-1-ylpenta-2,4-dien-1-amine (PubChem CID 139338168) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is (2E)-N,N-dimethyl-4-piperazin-1-ylpenta-2,4-dien-1-amine.
| Compound Name | (2E)-N,N-dimethyl-4-piperazin-1-ylpenta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 139338168 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | (2E)-N,N-dimethyl-4-piperazin-1-ylpenta-2,4-dien-1-amine |
| SMILES | C=C(/C=C/CN(C)C)N1CCNCC1 |
| InChI | InChI=1S/C11H21N3/c1-11(5-4-8-13(2)3)14-9-6-12-7-10-14/h4-5,12H,1,6-10H2,2-3H3/b5-4+ |
| InChIKey | JPJYSASYTOXRFT-SNAWJCMRSA-N |
| XLogP | 0.52 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|