C8H15N3 — CID 163552940
(1E)-3-piperazin-1-ylbuta-1,3-dien-1-amine (PubChem CID 163552940) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is (1E)-3-piperazin-1-ylbuta-1,3-dien-1-amine.
| Compound Name | (1E)-3-piperazin-1-ylbuta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 163552940 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | (1E)-3-piperazin-1-ylbuta-1,3-dien-1-amine |
| SMILES | C=C(/C=C/N)N1CCNCC1 |
| InChI | InChI=1S/C8H15N3/c1-8(2-3-9)11-6-4-10-5-7-11/h2-3,10H,1,4-7,9H2/b3-2+ |
| InChIKey | FKOVCIPGEHIIKW-NSCUHMNNSA-N |
| XLogP | -0.12 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|