C17H20FNO3 — CID 176580481
methyl 5-[1-(cyclopropanecarbonyl)piperidin-4-yl]-2-fluorobenzoate (PubChem CID 176580481) has the molecular formula C17H20FNO3 and a molecular weight of 305.35 g/mol. Its IUPAC name is methyl 5-[1-(cyclopropanecarbonyl)piperidin-4-yl]-2-fluorobenzoate.
| Compound Name | methyl 5-[1-(cyclopropanecarbonyl)piperidin-4-yl]-2-fluorobenzoate |
|---|---|
| PubChem CID | 176580481 |
| Molecular Formula | C17H20FNO3 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | methyl 5-[1-(cyclopropanecarbonyl)piperidin-4-yl]-2-fluorobenzoate |
| SMILES | COC(=O)c1cc(C2CCN(C(=O)C3CC3)CC2)ccc1F |
| InChI | InChI=1S/C17H20FNO3/c1-22-17(21)14-10-13(4-5-15(14)18)11-6-8-19(9-7-11)16(20)12-2-3-12/h4-5,10-12H,2-3,6-9H2,1H3 |
| InChIKey | XGGZJHZOYUZBBD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |