C16H20FN3O4 — CID 39998775
methyl 5-[[2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl]amino]-2-fluorobenzoate (PubChem CID 39998775) has the molecular formula C16H20FN3O4 and a molecular weight of 337.35 g/mol. Its IUPAC name is methyl 5-[[2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl]amino]-2-fluorobenzoate.
| Compound Name | methyl 5-[[2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl]amino]-2-fluorobenzoate |
|---|---|
| PubChem CID | 39998775 |
| Molecular Formula | C16H20FN3O4 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | methyl 5-[[2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl]amino]-2-fluorobenzoate |
| SMILES | COC(=O)c1cc(NCC(=O)N2CCC(C(N)=O)CC2)ccc1F |
| InChI | InChI=1S/C16H20FN3O4/c1-24-16(23)12-8-11(2-3-13(12)17)19-9-14(21)20-6-4-10(5-7-20)15(18)22/h2-3,8,10,19H,4-7,9H2,1H3,(H2,18,22) |
| InChIKey | GVVRXKSYYZTMOJ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |