C16H21FN2O4 — CID 95586043
methyl 5-[[2-[(2R)-2-ethylmorpholin-4-yl]-2-oxoethyl]amino]-2-fluorobenzoate (PubChem CID 95586043) has the molecular formula C16H21FN2O4 and a molecular weight of 324.35 g/mol. Its IUPAC name is methyl 5-[[2-[(2R)-2-ethylmorpholin-4-yl]-2-oxoethyl]amino]-2-fluorobenzoate.
| Compound Name | methyl 5-[[2-[(2R)-2-ethylmorpholin-4-yl]-2-oxoethyl]amino]-2-fluorobenzoate |
|---|---|
| PubChem CID | 95586043 |
| Molecular Formula | C16H21FN2O4 |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | methyl 5-[[2-[(2R)-2-ethylmorpholin-4-yl]-2-oxoethyl]amino]-2-fluorobenzoate |
| SMILES | CC[C@@H]1CN(C(=O)CNc2ccc(F)c(C(=O)OC)c2)CCO1 |
| InChI | InChI=1S/C16H21FN2O4/c1-3-12-10-19(6-7-23-12)15(20)9-18-11-4-5-14(17)13(8-11)16(21)22-2/h4-5,8,12,18H,3,6-7,9-10H2,1-2H3/t12-/m1/s1 |
| InChIKey | YICNHISWKAQUOQ-GFCCVEGCSA-N |
| XLogP | 1.66 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |