C12H14BF2NO4 — CID 146958506
2-(difluoromethoxy)-5-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)benzamide (PubChem CID 146958506) has the molecular formula C12H14BF2NO4 and a molecular weight of 285.06 g/mol. Its IUPAC name is 2-(difluoromethoxy)-5-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)benzamide.
| Compound Name | 2-(difluoromethoxy)-5-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)benzamide |
|---|---|
| PubChem CID | 146958506 |
| Molecular Formula | C12H14BF2NO4 |
| Molecular Weight | 285.06 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-(difluoromethoxy)-5-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| SMILES | CC1(C)COB(c2ccc(OC(F)F)c(C(N)=O)c2)O1 |
| InChI | InChI=1S/C12H14BF2NO4/c1-12(2)6-18-13(20-12)7-3-4-9(19-11(14)15)8(5-7)10(16)17/h3-5,11H,6H2,1-2H3,(H2,16,17) |
| InChIKey | AKCQQSZRGLWQGN-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.06 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|