C15H16BF2NO2 — CID 175467487
5'-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)-1,1-difluorospiro[cyclobutane-3,3'-indole] (PubChem CID 175467487) has the molecular formula C15H16BF2NO2 and a molecular weight of 291.11 g/mol. Its IUPAC name is 5'-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)-1,1-difluorospiro[cyclobutane-3,3'-indole].
| Compound Name | 5'-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)-1,1-difluorospiro[cyclobutane-3,3'-indole] |
|---|---|
| PubChem CID | 175467487 |
| Molecular Formula | C15H16BF2NO2 |
| Molecular Weight | 291.11 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 5'-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)-1,1-difluorospiro[cyclobutane-3,3'-indole] |
| SMILES | CC1(C)COB(c2ccc3c(c2)C2(C=N3)CC(F)(F)C2)O1 |
| InChI | InChI=1S/C15H16BF2NO2/c1-13(2)9-20-16(21-13)10-3-4-12-11(5-10)14(8-19-12)6-15(17,18)7-14/h3-5,8H,6-7,9H2,1-2H3 |
| InChIKey | DVLYDTULSATNBM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.11 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|