C11H14BBrO2 — CID 18987820
2-[4-(bromomethyl)phenyl]-4,4-dimethyl-1,3,2-dioxaborolane (PubChem CID 18987820) has the molecular formula C11H14BBrO2 and a molecular weight of 268.95 g/mol. Its IUPAC name is 2-[4-(bromomethyl)phenyl]-4,4-dimethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-(bromomethyl)phenyl]-4,4-dimethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 18987820 |
| Molecular Formula | C11H14BBrO2 |
| Molecular Weight | 268.95 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 2-[4-(bromomethyl)phenyl]-4,4-dimethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)COB(c2ccc(CBr)cc2)O1 |
| InChI | InChI=1S/C11H14BBrO2/c1-11(2)8-14-12(15-11)10-5-3-9(7-13)4-6-10/h3-6H,7-8H2,1-2H3 |
| InChIKey | RASNTIHUJSXULR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.95 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|