C16H22BNO4 — CID 150642684
1-[3-[[4-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]azetidin-1-yl]ethanone (PubChem CID 150642684) has the molecular formula C16H22BNO4 and a molecular weight of 303.17 g/mol. Its IUPAC name is 1-[3-[[4-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]azetidin-1-yl]ethanone.
| Compound Name | 1-[3-[[4-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]azetidin-1-yl]ethanone |
|---|---|
| PubChem CID | 150642684 |
| Molecular Formula | C16H22BNO4 |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 1-[3-[[4-(4,4-dimethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]azetidin-1-yl]ethanone |
| SMILES | CC(=O)N1CC(COc2ccc(B3OCC(C)(C)O3)cc2)C1 |
| InChI | InChI=1S/C16H22BNO4/c1-12(19)18-8-13(9-18)10-20-15-6-4-14(5-7-15)17-21-11-16(2,3)22-17/h4-7,13H,8-11H2,1-3H3 |
| InChIKey | JAGCEHLNBXAMOC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|