C24H29BN2O5 — CID 123879143
(4Z)-2-[4-[[1-(2,6-dimethylphenyl)pyrrolidin-3-yl]methoxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocine-4,8-diol (PubChem CID 123879143) has the molecular formula C24H29BN2O5 and a molecular weight of 436.32 g/mol. Its IUPAC name is (4Z)-2-[4-[[1-(2,6-dimethylphenyl)pyrrolidin-3-yl]methoxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocine-4,8-diol.
| Compound Name | (4Z)-2-[4-[[1-(2,6-dimethylphenyl)pyrrolidin-3-yl]methoxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocine-4,8-diol |
|---|---|
| PubChem CID | 123879143 |
| Molecular Formula | C24H29BN2O5 |
| Molecular Weight | 436.32 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | (4Z)-2-[4-[[1-(2,6-dimethylphenyl)pyrrolidin-3-yl]methoxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocine-4,8-diol |
| SMILES | Cc1cccc(C)c1N1CCC(COc2ccc(B3OC(O)=CN(C)/C=C(/O)O3)cc2)C1 |
| InChI | InChI=1S/C24H29BN2O5/c1-17-5-4-6-18(2)24(17)27-12-11-19(13-27)16-30-21-9-7-20(8-10-21)25-31-22(28)14-26(3)15-23(29)32-25/h4-10,14-15,19,28-29H,11-13,16H2,1-3H3/b22-14-,23-15? |
| InChIKey | MOEJHTGLTBPMNB-RGUAWGTLSA-N |
| XLogP | 3.60 |
| TPSA | 74.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|