C33H43BN2O7Si — CID 123261994
(4Z)-2-[4-[[3-[6-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2,4-dimethyl-3-pyridinyl]phenyl]methoxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocine-4,8-diol (PubChem CID 123261994) has the molecular formula C33H43BN2O7Si and a molecular weight of 618.61 g/mol. Its IUPAC name is (4Z)-2-[4-[[3-[6-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2,4-dimethyl-3-pyridinyl]phenyl]methoxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocine-4,8-diol.
| Compound Name | (4Z)-2-[4-[[3-[6-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2,4-dimethyl-3-pyridinyl]phenyl]methoxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocine-4,8-diol |
|---|---|
| PubChem CID | 123261994 |
| Molecular Formula | C33H43BN2O7Si |
| Molecular Weight | 618.61 g/mol |
| Exact Mass | 618.29 |
| IUPAC Name | (4Z)-2-[4-[[3-[6-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2,4-dimethyl-3-pyridinyl]phenyl]methoxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocine-4,8-diol |
| SMILES | Cc1cc(OCCO[Si](C)(C)C(C)(C)C)nc(C)c1-c1cccc(COc2ccc(B3OC(O)=CN(C)/C=C(/O)O3)cc2)c1 |
| InChI | InChI=1S/C33H43BN2O7Si/c1-23-18-29(39-16-17-41-44(7,8)33(3,4)5)35-24(2)32(23)26-11-9-10-25(19-26)22-40-28-14-12-27(13-15-28)34-42-30(37)20-36(6)21-31(38)43-34/h9-15,18-21,37-38H,16-17,22H2,1-8H3/b30-20-,31-21? |
| InChIKey | PUFJYFHEECXZCT-GYNALDAISA-N |
| XLogP | 6.73 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.61 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|