C31H44BNO4Si — CID 123235911
[4-[[3-[4-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-2,6-dimethylphenyl]phenyl]methoxy]phenyl]-N-methylboronamidic acid (PubChem CID 123235911) has the molecular formula C31H44BNO4Si and a molecular weight of 533.59 g/mol. Its IUPAC name is [4-[[3-[4-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-2,6-dimethylphenyl]phenyl]methoxy]phenyl]-N-methylboronamidic acid.
| Compound Name | [4-[[3-[4-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-2,6-dimethylphenyl]phenyl]methoxy]phenyl]-N-methylboronamidic acid |
|---|---|
| PubChem CID | 123235911 |
| Molecular Formula | C31H44BNO4Si |
| Molecular Weight | 533.59 g/mol |
| Exact Mass | 533.31 |
| IUPAC Name | [4-[[3-[4-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-2,6-dimethylphenyl]phenyl]methoxy]phenyl]-N-methylboronamidic acid |
| SMILES | CNB(O)c1ccc(OCc2cccc(-c3c(C)cc(OCCCO[Si](C)(C)C(C)(C)C)cc3C)c2)cc1 |
| InChI | InChI=1S/C31H44BNO4Si/c1-23-19-29(35-17-10-18-37-38(7,8)31(3,4)5)20-24(2)30(23)26-12-9-11-25(21-26)22-36-28-15-13-27(14-16-28)32(34)33-6/h9,11-16,19-21,33-34H,10,17-18,22H2,1-8H3 |
| InChIKey | XZQVBIUWOWEPNZ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.59 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|