C24H22BNO6 — CID 123914087
(4Z)-6-methyl-2-[4-[(4-phenoxyphenyl)methoxy]phenyl]-1,3,6,2-dioxazaborocine-4,8-diol (PubChem CID 123914087) has the molecular formula C24H22BNO6 and a molecular weight of 431.25 g/mol. Its IUPAC name is (4Z)-6-methyl-2-[4-[(4-phenoxyphenyl)methoxy]phenyl]-1,3,6,2-dioxazaborocine-4,8-diol.
| Compound Name | (4Z)-6-methyl-2-[4-[(4-phenoxyphenyl)methoxy]phenyl]-1,3,6,2-dioxazaborocine-4,8-diol |
|---|---|
| PubChem CID | 123914087 |
| Molecular Formula | C24H22BNO6 |
| Molecular Weight | 431.25 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | (4Z)-6-methyl-2-[4-[(4-phenoxyphenyl)methoxy]phenyl]-1,3,6,2-dioxazaborocine-4,8-diol |
| SMILES | CN1C=C(O)OB(c2ccc(OCc3ccc(Oc4ccccc4)cc3)cc2)O/C(O)=C\1 |
| InChI | InChI=1S/C24H22BNO6/c1-26-15-23(27)31-25(32-24(28)16-26)19-9-13-20(14-10-19)29-17-18-7-11-22(12-8-18)30-21-5-3-2-4-6-21/h2-16,27-28H,17H2,1H3/b23-15-,24-16? |
| InChIKey | AIHPKAHGWQPCDJ-NMWLGCIISA-N |
| XLogP | 4.45 |
| TPSA | 80.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.25 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|