C30H33BFNO7 — CID 123322075
(4Z,7Z)-2-[4-[[3-[4-(2-ethoxyethoxy)-3-fluoro-2,6-dimethylphenyl]phenyl]methoxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocine-4,8-diol (PubChem CID 123322075) has the molecular formula C30H33BFNO7 and a molecular weight of 549.40 g/mol. Its IUPAC name is (4Z,7Z)-2-[4-[[3-[4-(2-ethoxyethoxy)-3-fluoro-2,6-dimethylphenyl]phenyl]methoxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocine-4,8-diol.
| Compound Name | (4Z,7Z)-2-[4-[[3-[4-(2-ethoxyethoxy)-3-fluoro-2,6-dimethylphenyl]phenyl]methoxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocine-4,8-diol |
|---|---|
| PubChem CID | 123322075 |
| Molecular Formula | C30H33BFNO7 |
| Molecular Weight | 549.40 g/mol |
| Exact Mass | 549.23 |
| IUPAC Name | (4Z,7Z)-2-[4-[[3-[4-(2-ethoxyethoxy)-3-fluoro-2,6-dimethylphenyl]phenyl]methoxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocine-4,8-diol |
| SMILES | CCOCCOc1cc(C)c(-c2cccc(COc3ccc(B4O/C(O)=C\N(C)/C=C(/O)O4)cc3)c2)c(C)c1F |
| InChI | InChI=1S/C30H33BFNO7/c1-5-36-13-14-37-26-15-20(2)29(21(3)30(26)32)23-8-6-7-22(16-23)19-38-25-11-9-24(10-12-25)31-39-27(34)17-33(4)18-28(35)40-31/h6-12,15-18,34-35H,5,13-14,19H2,1-4H3/b27-17-,28-18- |
| InChIKey | GTUNWMUKFQRUMU-HJTNQMAYSA-N |
| XLogP | 5.49 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.40 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|