C17H20O5 — CID 173298642
benzene-1,3-diol;4-(2-ethoxyethoxy)benzaldehyde (PubChem CID 173298642) has the molecular formula C17H20O5 and a molecular weight of 304.34 g/mol. Its IUPAC name is benzene-1,3-diol;4-(2-ethoxyethoxy)benzaldehyde.
| Compound Name | benzene-1,3-diol;4-(2-ethoxyethoxy)benzaldehyde |
|---|---|
| PubChem CID | 173298642 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | benzene-1,3-diol;4-(2-ethoxyethoxy)benzaldehyde |
| SMILES | CCOCCOc1ccc(C=O)cc1.Oc1cccc(O)c1 |
| InChI | InChI=1S/C11H14O3.C6H6O2/c1-2-13-7-8-14-11-5-3-10(9-12)4-6-11;7-5-2-1-3-6(8)4-5/h3-6,9H,2,7-8H2,1H3;1-4,7-8H |
| InChIKey | RFHZYPBMQYKUSP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|