C32H36BNO8 — CID 77283971
2-[4-[[3-[4-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2,6-dimethylphenyl]phenyl]methoxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione (PubChem CID 77283971) has the molecular formula C32H36BNO8 and a molecular weight of 573.45 g/mol. Its IUPAC name is 2-[4-[[3-[4-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2,6-dimethylphenyl]phenyl]methoxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione.
| Compound Name | 2-[4-[[3-[4-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2,6-dimethylphenyl]phenyl]methoxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
|---|---|
| PubChem CID | 77283971 |
| Molecular Formula | C32H36BNO8 |
| Molecular Weight | 573.45 g/mol |
| Exact Mass | 573.25 |
| IUPAC Name | 2-[4-[[3-[4-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-2,6-dimethylphenyl]phenyl]methoxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
| SMILES | Cc1cc(OCC2COC(C)(C)O2)cc(C)c1-c1cccc(COc2ccc(B3OC(=O)CN(C)CC(=O)O3)cc2)c1 |
| InChI | InChI=1S/C32H36BNO8/c1-21-13-27(38-19-28-20-39-32(3,4)40-28)14-22(2)31(21)24-8-6-7-23(15-24)18-37-26-11-9-25(10-12-26)33-41-29(35)16-34(5)17-30(36)42-33/h6-15,28H,16-20H2,1-5H3 |
| InChIKey | CHVYTOCJLXCSBD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|