C29H33BN2O8S — CID 67986973
2-[4-[[3-[2,5-dimethyl-6-(3-methylsulfonylpropoxy)-3-pyridinyl]phenyl]methoxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione (PubChem CID 67986973) has the molecular formula C29H33BN2O8S and a molecular weight of 580.47 g/mol. Its IUPAC name is 2-[4-[[3-[2,5-dimethyl-6-(3-methylsulfonylpropoxy)-3-pyridinyl]phenyl]methoxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione.
| Compound Name | 2-[4-[[3-[2,5-dimethyl-6-(3-methylsulfonylpropoxy)-3-pyridinyl]phenyl]methoxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
|---|---|
| PubChem CID | 67986973 |
| Molecular Formula | C29H33BN2O8S |
| Molecular Weight | 580.47 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | 2-[4-[[3-[2,5-dimethyl-6-(3-methylsulfonylpropoxy)-3-pyridinyl]phenyl]methoxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
| SMILES | Cc1cc(-c2cccc(COc3ccc(B4OC(=O)CN(C)CC(=O)O4)cc3)c2)c(C)nc1OCCCS(C)(=O)=O |
| InChI | InChI=1S/C29H33BN2O8S/c1-20-15-26(21(2)31-29(20)37-13-6-14-41(4,35)36)23-8-5-7-22(16-23)19-38-25-11-9-24(10-12-25)30-39-27(33)17-32(3)18-28(34)40-30/h5,7-12,15-16H,6,13-14,17-19H2,1-4H3 |
| InChIKey | IDJKIZKCLMNEMS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 121.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.47 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|