C28H29ClO7S — CID 71715271
2-[3-[4-[[3-[2-chloro-4-(3-methylsulfonylpropoxy)phenyl]phenyl]methoxy]phenyl]oxetan-3-yl]acetic acid (PubChem CID 71715271) has the molecular formula C28H29ClO7S and a molecular weight of 545.05 g/mol. Its IUPAC name is 2-[3-[4-[[3-[2-chloro-4-(3-methylsulfonylpropoxy)phenyl]phenyl]methoxy]phenyl]oxetan-3-yl]acetic acid.
| Compound Name | 2-[3-[4-[[3-[2-chloro-4-(3-methylsulfonylpropoxy)phenyl]phenyl]methoxy]phenyl]oxetan-3-yl]acetic acid |
|---|---|
| PubChem CID | 71715271 |
| Molecular Formula | C28H29ClO7S |
| Molecular Weight | 545.05 g/mol |
| Exact Mass | 544.13 |
| IUPAC Name | 2-[3-[4-[[3-[2-chloro-4-(3-methylsulfonylpropoxy)phenyl]phenyl]methoxy]phenyl]oxetan-3-yl]acetic acid |
| SMILES | CS(=O)(=O)CCCOc1ccc(-c2cccc(COc3ccc(C4(CC(=O)O)COC4)cc3)c2)c(Cl)c1 |
| InChI | InChI=1S/C28H29ClO7S/c1-37(32,33)13-3-12-35-24-10-11-25(26(29)15-24)21-5-2-4-20(14-21)17-36-23-8-6-22(7-9-23)28(16-27(30)31)18-34-19-28/h2,4-11,14-15H,3,12-13,16-19H2,1H3,(H,30,31) |
| InChIKey | HWVDJYYKCVTJQP-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.05 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|