C19H16F4O5 — CID 71715836
2-[3-[4-[[3-fluoro-5-(trifluoromethoxy)phenyl]methoxy]phenyl]oxetan-3-yl]acetic acid (PubChem CID 71715836) has the molecular formula C19H16F4O5 and a molecular weight of 400.32 g/mol. Its IUPAC name is 2-[3-[4-[[3-fluoro-5-(trifluoromethoxy)phenyl]methoxy]phenyl]oxetan-3-yl]acetic acid.
| Compound Name | 2-[3-[4-[[3-fluoro-5-(trifluoromethoxy)phenyl]methoxy]phenyl]oxetan-3-yl]acetic acid |
|---|---|
| PubChem CID | 71715836 |
| Molecular Formula | C19H16F4O5 |
| Molecular Weight | 400.32 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 2-[3-[4-[[3-fluoro-5-(trifluoromethoxy)phenyl]methoxy]phenyl]oxetan-3-yl]acetic acid |
| SMILES | O=C(O)CC1(c2ccc(OCc3cc(F)cc(OC(F)(F)F)c3)cc2)COC1 |
| InChI | InChI=1S/C19H16F4O5/c20-14-5-12(6-16(7-14)28-19(21,22)23)9-27-15-3-1-13(2-4-15)18(8-17(24)25)10-26-11-18/h1-7H,8-11H2,(H,24,25) |
| InChIKey | UUPGNLPRVUUQHZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.32 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |