C21H20F4O5 — CID 71715892
ethyl 2-[3-[4-[[3-fluoro-5-(trifluoromethoxy)phenyl]methoxy]phenyl]oxetan-3-yl]acetate (PubChem CID 71715892) has the molecular formula C21H20F4O5 and a molecular weight of 428.38 g/mol. Its IUPAC name is ethyl 2-[3-[4-[[3-fluoro-5-(trifluoromethoxy)phenyl]methoxy]phenyl]oxetan-3-yl]acetate.
| Compound Name | ethyl 2-[3-[4-[[3-fluoro-5-(trifluoromethoxy)phenyl]methoxy]phenyl]oxetan-3-yl]acetate |
|---|---|
| PubChem CID | 71715892 |
| Molecular Formula | C21H20F4O5 |
| Molecular Weight | 428.38 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | ethyl 2-[3-[4-[[3-fluoro-5-(trifluoromethoxy)phenyl]methoxy]phenyl]oxetan-3-yl]acetate |
| SMILES | CCOC(=O)CC1(c2ccc(OCc3cc(F)cc(OC(F)(F)F)c3)cc2)COC1 |
| InChI | InChI=1S/C21H20F4O5/c1-2-28-19(26)10-20(12-27-13-20)15-3-5-17(6-4-15)29-11-14-7-16(22)9-18(8-14)30-21(23,24)25/h3-9H,2,10-13H2,1H3 |
| InChIKey | BHYARSVBDQKPCE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |