C21H20F4O4 — CID 71715835
ethyl 2-[3-[4-[[3-fluoro-4-(trifluoromethyl)phenyl]methoxy]phenyl]oxetan-3-yl]acetate (PubChem CID 71715835) has the molecular formula C21H20F4O4 and a molecular weight of 412.38 g/mol. Its IUPAC name is ethyl 2-[3-[4-[[3-fluoro-4-(trifluoromethyl)phenyl]methoxy]phenyl]oxetan-3-yl]acetate.
| Compound Name | ethyl 2-[3-[4-[[3-fluoro-4-(trifluoromethyl)phenyl]methoxy]phenyl]oxetan-3-yl]acetate |
|---|---|
| PubChem CID | 71715835 |
| Molecular Formula | C21H20F4O4 |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | ethyl 2-[3-[4-[[3-fluoro-4-(trifluoromethyl)phenyl]methoxy]phenyl]oxetan-3-yl]acetate |
| SMILES | CCOC(=O)CC1(c2ccc(OCc3ccc(C(F)(F)F)c(F)c3)cc2)COC1 |
| InChI | InChI=1S/C21H20F4O4/c1-2-28-19(26)10-20(12-27-13-20)15-4-6-16(7-5-15)29-11-14-3-8-17(18(22)9-14)21(23,24)25/h3-9H,2,10-13H2,1H3 |
| InChIKey | IMSCHYBTEJHJFX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |