C25H26N2O5 — CID 86302237
ethyl 2-[3-[4-[[3-(4-methylpyrimidin-5-yl)phenyl]methoxy]phenyl]oxetan-3-yl]oxyacetate (PubChem CID 86302237) has the molecular formula C25H26N2O5 and a molecular weight of 434.49 g/mol. Its IUPAC name is ethyl 2-[3-[4-[[3-(4-methylpyrimidin-5-yl)phenyl]methoxy]phenyl]oxetan-3-yl]oxyacetate.
| Compound Name | ethyl 2-[3-[4-[[3-(4-methylpyrimidin-5-yl)phenyl]methoxy]phenyl]oxetan-3-yl]oxyacetate |
|---|---|
| PubChem CID | 86302237 |
| Molecular Formula | C25H26N2O5 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | ethyl 2-[3-[4-[[3-(4-methylpyrimidin-5-yl)phenyl]methoxy]phenyl]oxetan-3-yl]oxyacetate |
| SMILES | CCOC(=O)COC1(c2ccc(OCc3cccc(-c4cncnc4C)c3)cc2)COC1 |
| InChI | InChI=1S/C25H26N2O5/c1-3-30-24(28)14-32-25(15-29-16-25)21-7-9-22(10-8-21)31-13-19-5-4-6-20(11-19)23-12-26-17-27-18(23)2/h4-12,17H,3,13-16H2,1-2H3 |
| InChIKey | GWWGOJPHRZAGQQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |