C28H29NO7 — CID 144798742
2-[3-[4-[[4-[2-methoxyimino-2-(3-methoxyphenyl)ethoxy]phenyl]methoxy]phenyl]oxetan-3-yl]acetic acid (PubChem CID 144798742) has the molecular formula C28H29NO7 and a molecular weight of 491.54 g/mol. Its IUPAC name is 2-[3-[4-[[4-[2-methoxyimino-2-(3-methoxyphenyl)ethoxy]phenyl]methoxy]phenyl]oxetan-3-yl]acetic acid.
| Compound Name | 2-[3-[4-[[4-[2-methoxyimino-2-(3-methoxyphenyl)ethoxy]phenyl]methoxy]phenyl]oxetan-3-yl]acetic acid |
|---|---|
| PubChem CID | 144798742 |
| Molecular Formula | C28H29NO7 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 2-[3-[4-[[4-[2-methoxyimino-2-(3-methoxyphenyl)ethoxy]phenyl]methoxy]phenyl]oxetan-3-yl]acetic acid |
| SMILES | CON=C(COc1ccc(COc2ccc(C3(CC(=O)O)COC3)cc2)cc1)c1cccc(OC)c1 |
| InChI | InChI=1S/C28H29NO7/c1-32-25-5-3-4-21(14-25)26(29-33-2)17-36-23-10-6-20(7-11-23)16-35-24-12-8-22(9-13-24)28(15-27(30)31)18-34-19-28/h3-14H,15-19H2,1-2H3,(H,30,31) |
| InChIKey | RKDWMKZQCQJZAV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 95.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|