C20H17F3N2O2 — CID 58289339
5-[[4-[4-(trifluoromethoxy)phenyl]phenoxy]methyl]benzene-1,3-diamine (PubChem CID 58289339) has the molecular formula C20H17F3N2O2 and a molecular weight of 374.36 g/mol. Its IUPAC name is 5-[[4-[4-(trifluoromethoxy)phenyl]phenoxy]methyl]benzene-1,3-diamine.
| Compound Name | 5-[[4-[4-(trifluoromethoxy)phenyl]phenoxy]methyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 58289339 |
| Molecular Formula | C20H17F3N2O2 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 5-[[4-[4-(trifluoromethoxy)phenyl]phenoxy]methyl]benzene-1,3-diamine |
| SMILES | Nc1cc(N)cc(COc2ccc(-c3ccc(OC(F)(F)F)cc3)cc2)c1 |
| InChI | InChI=1S/C20H17F3N2O2/c21-20(22,23)27-19-7-3-15(4-8-19)14-1-5-18(6-2-14)26-12-13-9-16(24)11-17(25)10-13/h1-11H,12,24-25H2 |
| InChIKey | HHQWSBPOUKHMLH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|