C20H26O4S — CID 67129345
2-methylpropan-2-ol;4-(3-methylsulfonylpropoxy)tricyclo[6.3.1.02,7]dodeca-1(11),2(7),3,5,8(12),9-hexaene (PubChem CID 67129345) has the molecular formula C20H26O4S and a molecular weight of 362.49 g/mol. Its IUPAC name is 2-methylpropan-2-ol;4-(3-methylsulfonylpropoxy)tricyclo[6.3.1.02,7]dodeca-1(11),2(7),3,5,8(12),9-hexaene.
| Compound Name | 2-methylpropan-2-ol;4-(3-methylsulfonylpropoxy)tricyclo[6.3.1.02,7]dodeca-1(11),2(7),3,5,8(12),9-hexaene |
|---|---|
| PubChem CID | 67129345 |
| Molecular Formula | C20H26O4S |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 2-methylpropan-2-ol;4-(3-methylsulfonylpropoxy)tricyclo[6.3.1.02,7]dodeca-1(11),2(7),3,5,8(12),9-hexaene |
| SMILES | CC(C)(C)O.CS(=O)(=O)CCCOc1ccc2c(c1)-c1cccc-2c1 |
| InChI | InChI=1S/C16H16O3S.C4H10O/c1-20(17,18)9-3-8-19-14-6-7-15-12-4-2-5-13(10-12)16(15)11-14;1-4(2,3)5/h2,4-7,10-11H,3,8-9H2,1H3;5H,1-3H3 |
| InChIKey | VQHDVVNMMQABOJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|