C30H28FNO5S — CID 123231505
methyl 3-[7-fluoro-2-[3-[2-methyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]quinolin-6-yl]prop-2-enoate (PubChem CID 123231505) has the molecular formula C30H28FNO5S and a molecular weight of 533.62 g/mol. Its IUPAC name is methyl 3-[7-fluoro-2-[3-[2-methyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]quinolin-6-yl]prop-2-enoate.
| Compound Name | methyl 3-[7-fluoro-2-[3-[2-methyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]quinolin-6-yl]prop-2-enoate |
|---|---|
| PubChem CID | 123231505 |
| Molecular Formula | C30H28FNO5S |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | methyl 3-[7-fluoro-2-[3-[2-methyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]quinolin-6-yl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1cc2ccc(-c3cccc(-c4ccc(OCCCS(C)(=O)=O)cc4C)c3)nc2cc1F |
| InChI | InChI=1S/C30H28FNO5S/c1-20-16-25(37-14-5-15-38(3,34)35)10-11-26(20)21-6-4-7-23(17-21)28-12-8-24-18-22(9-13-30(33)36-2)27(31)19-29(24)32-28/h4,6-13,16-19H,5,14-15H2,1-3H3 |
| InChIKey | UWUZNIJNGVTVKL-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|