C32H32FNO5S — CID 123697673
methyl 3-[2-[3-[4-(3-ethylsulfonylpropoxy)-2,6-dimethylphenyl]phenyl]-7-fluoroquinolin-6-yl]prop-2-enoate (PubChem CID 123697673) has the molecular formula C32H32FNO5S and a molecular weight of 561.68 g/mol. Its IUPAC name is methyl 3-[2-[3-[4-(3-ethylsulfonylpropoxy)-2,6-dimethylphenyl]phenyl]-7-fluoroquinolin-6-yl]prop-2-enoate.
| Compound Name | methyl 3-[2-[3-[4-(3-ethylsulfonylpropoxy)-2,6-dimethylphenyl]phenyl]-7-fluoroquinolin-6-yl]prop-2-enoate |
|---|---|
| PubChem CID | 123697673 |
| Molecular Formula | C32H32FNO5S |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | methyl 3-[2-[3-[4-(3-ethylsulfonylpropoxy)-2,6-dimethylphenyl]phenyl]-7-fluoroquinolin-6-yl]prop-2-enoate |
| SMILES | CCS(=O)(=O)CCCOc1cc(C)c(-c2cccc(-c3ccc4cc(C=CC(=O)OC)c(F)cc4n3)c2)c(C)c1 |
| InChI | InChI=1S/C32H32FNO5S/c1-5-40(36,37)15-7-14-39-27-16-21(2)32(22(3)17-27)26-9-6-8-24(19-26)29-12-10-25-18-23(11-13-31(35)38-4)28(33)20-30(25)34-29/h6,8-13,16-20H,5,7,14-15H2,1-4H3 |
| InChIKey | RCQURTIJWMYGNP-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|