C11H16O4S — CID 70926847
2-methyl-4-(3-methylsulfonylpropoxy)phenol (PubChem CID 70926847) has the molecular formula C11H16O4S and a molecular weight of 244.31 g/mol. Its IUPAC name is 2-methyl-4-(3-methylsulfonylpropoxy)phenol.
| Compound Name | 2-methyl-4-(3-methylsulfonylpropoxy)phenol |
|---|---|
| PubChem CID | 70926847 |
| Molecular Formula | C11H16O4S |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 2-methyl-4-(3-methylsulfonylpropoxy)phenol |
| SMILES | Cc1cc(OCCCS(C)(=O)=O)ccc1O |
| InChI | InChI=1S/C11H16O4S/c1-9-8-10(4-5-11(9)12)15-6-3-7-16(2,13)14/h4-5,8,12H,3,6-7H2,1-2H3 |
| InChIKey | BGPYLQSZVFYZOC-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|