C16H22O3S — CID 123584849
2-buta-1,3-dien-2-yl-1,3-dimethyl-5-(3-methylsulfonylpropoxy)benzene (PubChem CID 123584849) has the molecular formula C16H22O3S and a molecular weight of 294.42 g/mol. Its IUPAC name is 2-buta-1,3-dien-2-yl-1,3-dimethyl-5-(3-methylsulfonylpropoxy)benzene.
| Compound Name | 2-buta-1,3-dien-2-yl-1,3-dimethyl-5-(3-methylsulfonylpropoxy)benzene |
|---|---|
| PubChem CID | 123584849 |
| Molecular Formula | C16H22O3S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 2-buta-1,3-dien-2-yl-1,3-dimethyl-5-(3-methylsulfonylpropoxy)benzene |
| SMILES | C=CC(=C)c1c(C)cc(OCCCS(C)(=O)=O)cc1C |
| InChI | InChI=1S/C16H22O3S/c1-6-12(2)16-13(3)10-15(11-14(16)4)19-8-7-9-20(5,17)18/h6,10-11H,1-2,7-9H2,3-5H3 |
| InChIKey | CSJKHTIREGCTNN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|