C11H15BO3 — CID 172816293
2-(4-methoxyphenyl)-4,4-dimethyl-1,3,2-dioxaborolane (PubChem CID 172816293) has the molecular formula C11H15BO3 and a molecular weight of 206.05 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-4,4-dimethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(4-methoxyphenyl)-4,4-dimethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 172816293 |
| Molecular Formula | C11H15BO3 |
| Molecular Weight | 206.05 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 2-(4-methoxyphenyl)-4,4-dimethyl-1,3,2-dioxaborolane |
| SMILES | COc1ccc(B2OCC(C)(C)O2)cc1 |
| InChI | InChI=1S/C11H15BO3/c1-11(2)8-14-12(15-11)9-4-6-10(13-3)7-5-9/h4-7H,8H2,1-3H3 |
| InChIKey | SVWBCXYGFZQKTF-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.05 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|