C16H23BO3 — CID 58452861
2-(4-cyclopentyloxyphenyl)-5,5-dimethyl-1,3,2-dioxaborinane (PubChem CID 58452861) has the molecular formula C16H23BO3 and a molecular weight of 274.17 g/mol. Its IUPAC name is 2-(4-cyclopentyloxyphenyl)-5,5-dimethyl-1,3,2-dioxaborinane.
| Compound Name | 2-(4-cyclopentyloxyphenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 58452861 |
| Molecular Formula | C16H23BO3 |
| Molecular Weight | 274.17 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 2-(4-cyclopentyloxyphenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
| SMILES | CC1(C)COB(c2ccc(OC3CCCC3)cc2)OC1 |
| InChI | InChI=1S/C16H23BO3/c1-16(2)11-18-17(19-12-16)13-7-9-15(10-8-13)20-14-5-3-4-6-14/h7-10,14H,3-6,11-12H2,1-2H3 |
| InChIKey | LRGJPWJXJTYUNO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.17 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|